cas: 405888-56-4 — see every product listed under this CAS number, including other names
(5,6,7,8-Tetrahydronaphthalen-2-yl)boronic acid 98% (CAS 405888-56-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A855071-100mg |
| cas | 405888-56-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1171.38 Pln | |
| Ambeed | 5g | 3841.38 Pln | |
| Ambeed | 10g | 6355.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A855071 |
5,6,7,8-tetrahydronaphthalen-2-ylboronic acid (CAS 405888-56-4) is a chemical compound with the molecular formula C10H13BO2 and a molecular weight of 176.02 g/mol. IUPAC name: 5,6,7,8-tetrahydronaphthalen-2-ylboronic acid. InChIKey: LMASCDCJPOZWMK-UHFFFAOYSA-N.
| Molecular formula | C10H13BO2 |
|---|---|
| Molecular weight | 176.02 g/mol |
| IUPAC name | 5,6,7,8-tetrahydronaphthalen-2-ylboronic acid |
| InChIKey | LMASCDCJPOZWMK-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(CCCC2)C=C1)(O)O |
Computed by PubChem (NCBI)