Products 2121514-07-4
CAS 2121514-07-4 appears in our catalog under these names: 4-Cyclopropyl-2-methylphenylboronic acid, 95%, (4–cyclopropyl–2–methylphenyl)boronic acid, (4-Cyclopropyl-2-methylphenyl)boronic acid, 98%, 4-Cyclopropyl-2-methylphenylboronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, GLPBio, AmBeed, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 10mg, 25mg.
(4-cyclopropyl-2-methylphenyl)boronic acid (CAS 2121514-07-4) is a chemical compound with the molecular formula C10H13BO2 and a molecular weight of 176.02 g/mol. IUPAC name: (4-cyclopropyl-2-methylphenyl)boronic acid. InChIKey: YAXRAZBEKCHQRN-UHFFFAOYSA-N.
| Molecular formula | C10H13BO2 |
|---|---|
| Molecular weight | 176.02 g/mol |
| IUPAC name | (4-cyclopropyl-2-methylphenyl)boronic acid |
| InChIKey | YAXRAZBEKCHQRN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C2CC2)C)(O)O |
Computed by PubChem (NCBI)