CAS 845797-74-2 appears in our catalog under these names: 4-Cyclobutylphenylboronic acid, 95%, (4-Cyclobutylphenyl)boronic acid, (4-Cyclobutylphenyl)boronic acid 95+%, (4-Cyclobutylphenyl)boronic acid, 95%+, 95%+, (4-Cyclobutylphenyl)boronic acid, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 0,5g, 2g, 100mg.
(4-cyclobutylphenyl)boronic acid (CAS 845797-74-2) is a chemical compound with the molecular formula C10H13BO2 and a molecular weight of 176.02 g/mol. IUPAC name: (4-cyclobutylphenyl)boronic acid. InChIKey: WVCDYFJLBAMQSM-UHFFFAOYSA-N.
| Molecular formula | C10H13BO2 |
|---|---|
| Molecular weight | 176.02 g/mol |
| IUPAC name | (4-cyclobutylphenyl)boronic acid |
| InChIKey | WVCDYFJLBAMQSM-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2CCC2)(O)O |
Computed by PubChem (NCBI)