cas: 1072946-49-6 — see every product listed under this CAS number, including other names
(5-(((tert-Butoxycarbonyl)amino)methyl)furan-2-yl)boronic acid 95% (CAS 1072946-49-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A505648-100mg |
| cas | 1072946-49-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 392.62 Pln | |
| Ambeed | 250mg | 626.25 Pln | |
| Ambeed | 1g | 1594.12 Pln | |
| Ambeed | 5g | 3902.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A505648 |
[5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]furan-2-yl]boronic acid (CAS 1072946-49-6) is a chemical compound with the molecular formula C10H16BNO5 and a molecular weight of 241.05 g/mol. IUPAC name: [5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]furan-2-yl]boronic acid. InChIKey: CBDGXXNRURJOEV-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO5 |
|---|---|
| Molecular weight | 241.05 g/mol |
| IUPAC name | [5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]furan-2-yl]boronic acid |
| InChIKey | CBDGXXNRURJOEV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(O1)CNC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)