CAS 1072946-49-6 appears in our catalog under these names: 5-((Boc-Amino)methyl)furan-2-boronic acid, 98%, 5-((BOC-Amino)methyl)furan-2-boronic Acid, >95% (HPLC), (5-(((tert-Butoxycarbonyl)amino)methyl)furan-2-yl)boronic acid, 98%, 5-((BOC-Amino)methyl)furan-2-boronic acid, (5-(((tert-Butoxycarbonyl)amino)methyl)furan-2-yl)boronic acid 95%. Offered by: Combi-blocks, TRC, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg, 0,5g, 2g.
[5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]furan-2-yl]boronic acid (CAS 1072946-49-6) is a chemical compound with the molecular formula C10H16BNO5 and a molecular weight of 241.05 g/mol. IUPAC name: [5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]furan-2-yl]boronic acid. InChIKey: CBDGXXNRURJOEV-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO5 |
|---|---|
| Molecular weight | 241.05 g/mol |
| IUPAC name | [5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]furan-2-yl]boronic acid |
| InChIKey | CBDGXXNRURJOEV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(O1)CNC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)