5-((BOC-Amino)methyl)furan-2-boronic acid, 95%, 95%
cas: 1072946-49-6 — see every product listed under this CAS number, including other names
5-((BOC-Amino)methyl)furan-2-boronic acid, 95%, 95% (CAS 1072946-49-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BXH-100mg |
| cas | 1072946-49-6 |
| size | 100mg |
| availability | 15g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 486.80 Pln | |
| Chemat | 1g | 1230.80 Pln | |
| Chemat | 5g | 3002.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]furan-2-yl]boronic acid (CAS 1072946-49-6) is a chemical compound with the molecular formula C10H16BNO5 and a molecular weight of 241.05 g/mol. IUPAC name: [5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]furan-2-yl]boronic acid. InChIKey: CBDGXXNRURJOEV-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO5 |
|---|---|
| Molecular weight | 241.05 g/mol |
| IUPAC name | [5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]furan-2-yl]boronic acid |
| InChIKey | CBDGXXNRURJOEV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(O1)CNC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
[5-({[(tert-butoxy)carbonyl]amino}methyl)furan-2-yl]boronic acid, (5-((((tert-butoxy)carbonyl)amino)methyl)furan-2-yl)boronic acid, 5-((BOC-Amino)methyl)furan-2-boronic acid, (5-(((tert-Butoxycarbonyl)amino)methyl)furan-2-yl)boronic acid, [5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]furan-2-yl]boronic acid, (5-{[(tert-Butoxycarbonyl)amino]methyl}furan-2-yl)boronic acid, CBDGXXNRURJOEV-UHFFFAOYSA-N, (5-(((tert-Butoxycarbonyl)amino)-methyl)furan-2-yl)boronic acid, (5-(((tert-Butoxycarbonyl)amino)methyl)furan-2-yl)boronicacid