cas: 1150114-53-6 — see every product listed under this CAS number, including other names
(5-((tert-Butyldimethylsilyl)oxy)-2-fluorophenyl)boronic acid 98% (CAS 1150114-53-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A827131-100mg |
| cas | 1150114-53-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 3212.81 Pln | |
| Ambeed | 25g | 12340.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A827131 |
[5-[tert-butyl(dimethyl)silyl]oxy-2-fluorophenyl]boronic acid (CAS 1150114-53-6) is a chemical compound with the molecular formula C12H20BFO3Si and a molecular weight of 270.18 g/mol. IUPAC name: [5-[tert-butyl(dimethyl)silyl]oxy-2-fluorophenyl]boronic acid. InChIKey: TYKUASQVDUTDEJ-UHFFFAOYSA-N.
| Molecular formula | C12H20BFO3Si |
|---|---|
| Molecular weight | 270.18 g/mol |
| IUPAC name | [5-[tert-butyl(dimethyl)silyl]oxy-2-fluorophenyl]boronic acid |
| InChIKey | TYKUASQVDUTDEJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)O[Si](C)(C)C(C)(C)C)F)(O)O |
Computed by PubChem (NCBI)