CAS 2096331-47-2 appears in our catalog under these names: 3-(t-Butyldimethylsilyloxy)-2-fluorophenylboronic acid, 97%, 3-(t-Butyldimethylsilyloxy)-2-fluorophenylboronic acid, 97%, 97%, (3-((tert-Butyldimethylsilyl)oxy)-2-fluorophenyl)boronic acid 97%. Offered by: Combi-blocks, Fluorochem, Chemat, Ambeed. Available pack sizes: 5g, 10g, 1g, 25g, 100mg, 250mg.
[3-[tert-butyl(dimethyl)silyl]oxy-2-fluorophenyl]boronic acid (CAS 2096331-47-2) is a chemical compound with the molecular formula C12H20BFO3Si and a molecular weight of 270.18 g/mol. IUPAC name: [3-[tert-butyl(dimethyl)silyl]oxy-2-fluorophenyl]boronic acid. InChIKey: LARMLYKSRWOEDJ-UHFFFAOYSA-N.
| Molecular formula | C12H20BFO3Si |
|---|---|
| Molecular weight | 270.18 g/mol |
| IUPAC name | [3-[tert-butyl(dimethyl)silyl]oxy-2-fluorophenyl]boronic acid |
| InChIKey | LARMLYKSRWOEDJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)O[Si](C)(C)C(C)(C)C)F)(O)O |
Computed by PubChem (NCBI)