CAS 2377608-27-8 appears in our catalog under these names: {4-[(tert-Butyldimethylsilyl)oxy]-2-fluorophenyl}boronic acid, 98%, {4-((tert-Butyldimethylsilyl)oxy)-2-fluorophenyl}boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
[4-[tert-butyl(dimethyl)silyl]oxy-2-fluorophenyl]boronic acid (CAS 2377608-27-8) is a chemical compound with the molecular formula C12H20BFO3Si and a molecular weight of 270.18 g/mol. IUPAC name: [4-[tert-butyl(dimethyl)silyl]oxy-2-fluorophenyl]boronic acid. InChIKey: AARGCEYGIOTKNF-UHFFFAOYSA-N.
| Molecular formula | C12H20BFO3Si |
|---|---|
| Molecular weight | 270.18 g/mol |
| IUPAC name | [4-[tert-butyl(dimethyl)silyl]oxy-2-fluorophenyl]boronic acid |
| InChIKey | AARGCEYGIOTKNF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)O[Si](C)(C)C(C)(C)C)F)(O)O |
Computed by PubChem (NCBI)