(5-(Benzyloxy)-2-formylphenyl)boronic acid 96%
cas: 1226773-36-9 — see every product listed under this CAS number, including other names
(5-(Benzyloxy)-2-formylphenyl)boronic acid 96% (CAS 1226773-36-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A347195-100mg |
| cas | 1226773-36-9 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2584.25 Pln | |
| Ambeed | 10g | 4469.94 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A347195 |
(2-formyl-5-phenylmethoxyphenyl)boronic acid (CAS 1226773-36-9) is a chemical compound with the molecular formula C14H13BO4 and a molecular weight of 256.06 g/mol. IUPAC name: (2-formyl-5-phenylmethoxyphenyl)boronic acid. InChIKey: FEFDHTIODOFOKS-UHFFFAOYSA-N.
| Molecular formula | C14H13BO4 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | (2-formyl-5-phenylmethoxyphenyl)boronic acid |
| InChIKey | FEFDHTIODOFOKS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OCC2=CC=CC=C2)C=O)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(5-(Benzyloxy)-2-formylphenyl)boronic acid, 5-(Benzyloxy)-2-formylphenylboronic acid, (2-formyl-5-phenylmethoxyphenyl)boronic acid, [5-(Benzyloxy)-2-formylphenyl]boronic acid, Boronic acid, B-[2-formyl-5-(phenylmethoxy)phenyl]-, (5-benzyloxy-2-formyl-phenyl)boronic acid, (5-(Benzyloxy)-2-formylphenyl)boronicacid