CAS 1226773-36-9 appears in our catalog under these names: 5-(Benzyloxy)-2-formylphenylboronic acid, 96%, (5-(Benzyloxy)-2-formylphenyl)boronic acid, 96%, 96%, (5-(Benzyloxy)-2-formylphenyl)boronic acid, 96%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
(2-formyl-5-phenylmethoxyphenyl)boronic acid (CAS 1226773-36-9) is a chemical compound with the molecular formula C14H13BO4 and a molecular weight of 256.06 g/mol. IUPAC name: (2-formyl-5-phenylmethoxyphenyl)boronic acid. InChIKey: FEFDHTIODOFOKS-UHFFFAOYSA-N.
| Molecular formula | C14H13BO4 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | (2-formyl-5-phenylmethoxyphenyl)boronic acid |
| InChIKey | FEFDHTIODOFOKS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OCC2=CC=CC=C2)C=O)(O)O |
Computed by PubChem (NCBI)