CAS 121124-98-9 appears in our catalog under these names: 4-Benzyloxy-3-formylphenylboronic acid, 95%, (4-(Benzyloxy)-3-formylphenyl)boronic acid 95%, (4-(Benzyloxy)-3-formylphenyl)boronic acid, 95%, 95%, (4-(Benzyloxy)-3-formylphenyl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g.
(3-formyl-4-phenylmethoxyphenyl)boronic acid (CAS 121124-98-9) is a chemical compound with the molecular formula C14H13BO4 and a molecular weight of 256.06 g/mol. IUPAC name: (3-formyl-4-phenylmethoxyphenyl)boronic acid. InChIKey: SELUMTHJWHLSBV-UHFFFAOYSA-N.
| Molecular formula | C14H13BO4 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | (3-formyl-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | SELUMTHJWHLSBV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCC2=CC=CC=C2)C=O)(O)O |
Computed by PubChem (NCBI)