cas: 1018680-09-5 — see every product listed under this CAS number, including other names
(5-(Dimethylamino)pyridin-3-yl)boronic acid, 95% (CAS 1018680-09-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F790831-100MG |
| cas | 1018680-09-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 857.01 Pln | |
| Fluorochem | 250mg | 1388.07 Pln | |
| Fluorochem | 1g | 3231.17 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[5-(dimethylamino)-3-pyridinyl]boronic acid (CAS 1018680-09-5) is a chemical compound with the molecular formula C7H11BN2O2 and a molecular weight of 165.99 g/mol. IUPAC name: [5-(dimethylamino)-3-pyridinyl]boronic acid. InChIKey: XONOLKVBZTVRBK-UHFFFAOYSA-N.
| Molecular formula | C7H11BN2O2 |
|---|---|
| Molecular weight | 165.99 g/mol |
| IUPAC name | [5-(dimethylamino)-3-pyridinyl]boronic acid |
| InChIKey | XONOLKVBZTVRBK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1)N(C)C)(O)O |
Computed by PubChem (NCBI)