CAS 579525-46-5 appears in our catalog under these names: 6-(Dimethylamino)pyridine-3-boronic acid, 98%, 6-(Dimethylamino)pyridine-3-boronic acid, [6-(Dimethylamino)pyridin-3-yl]boronic acid, 95%, 95%, [6-(Dimethylamino)pyridin-3-yl]boronic acid, 95%. Offered by: Combi-blocks, TRC, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 500mg, 100mg.
[6-(dimethylamino)-3-pyridinyl]boronic acid (CAS 579525-46-5) is a chemical compound with the molecular formula C7H11BN2O2 and a molecular weight of 165.99 g/mol. IUPAC name: [6-(dimethylamino)-3-pyridinyl]boronic acid. InChIKey: NIDRXNINGRRBFV-UHFFFAOYSA-N.
| Molecular formula | C7H11BN2O2 |
|---|---|
| Molecular weight | 165.99 g/mol |
| IUPAC name | [6-(dimethylamino)-3-pyridinyl]boronic acid |
| InChIKey | NIDRXNINGRRBFV-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)N(C)C)(O)O |
Computed by PubChem (NCBI)