CAS 1312942-16-7 appears in our catalog under these names: (2-Isopropylpyrimidin-5-yl)boronic acid, 95%, (2-Isopropylpyrimidin-5-yl)boronic acid, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
(2-propan-2-ylpyrimidin-5-yl)boronic acid (CAS 1312942-16-7) is a chemical compound with the molecular formula C7H11BN2O2 and a molecular weight of 165.99 g/mol. IUPAC name: (2-propan-2-ylpyrimidin-5-yl)boronic acid. InChIKey: JVYHCLGHZUTXHU-UHFFFAOYSA-N.
| Molecular formula | C7H11BN2O2 |
|---|---|
| Molecular weight | 165.99 g/mol |
| IUPAC name | (2-propan-2-ylpyrimidin-5-yl)boronic acid |
| InChIKey | JVYHCLGHZUTXHU-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1)C(C)C)(O)O |
Computed by PubChem (NCBI)