cas: 876189-20-7 — see every product listed under this CAS number, including other names
(5-(Methoxycarbonyl)furan-2-yl)boronic acid 95% (CAS 876189-20-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A512873-100mg |
| cas | 876189-20-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1638.62 Pln | |
| Ambeed | 25g | 6878.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A512873 |
(5-methoxycarbonylfuran-2-yl)boronic acid (CAS 876189-20-7) is a chemical compound with the molecular formula C6H7BO5 and a molecular weight of 169.93 g/mol. IUPAC name: (5-methoxycarbonylfuran-2-yl)boronic acid. InChIKey: PGQQERRFTSQHHN-UHFFFAOYSA-N.
| Molecular formula | C6H7BO5 |
|---|---|
| Molecular weight | 169.93 g/mol |
| IUPAC name | (5-methoxycarbonylfuran-2-yl)boronic acid |
| InChIKey | PGQQERRFTSQHHN-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(O1)C(=O)OC)(O)O |
Computed by PubChem (NCBI)