CAS 868286-61-7 appears in our catalog under these names: 3-(Methoxycarbonyl)furan-2-boronic acid, 95%, (3-(Methoxycarbonyl)furan-2-yl)boronic acid, 95%, (3-(Methoxycarbonyl)furan-2-yl)boronic acid 95%, (3-(Methoxycarbonyl)furan-2-yl)boronic acid, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, Ambeed, Chemat. Available pack sizes: 1g, 250mg, on request, 100mg.
(3-methoxycarbonylfuran-2-yl)boronic acid (CAS 868286-61-7) is a chemical compound with the molecular formula C6H7BO5 and a molecular weight of 169.93 g/mol. IUPAC name: (3-methoxycarbonylfuran-2-yl)boronic acid. InChIKey: HJVVEQXVFDXEDT-UHFFFAOYSA-N.
| Molecular formula | C6H7BO5 |
|---|---|
| Molecular weight | 169.93 g/mol |
| IUPAC name | (3-methoxycarbonylfuran-2-yl)boronic acid |
| InChIKey | HJVVEQXVFDXEDT-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CO1)C(=O)OC)(O)O |
Computed by PubChem (NCBI)