CAS 876189-20-7 appears in our catalog under these names: 5-(Methoxycarbonyl)furan-2-boronic acid, 98%, (5-(Methoxycarbonyl)furan-2-yl)boronic acid 95%, (5-(Methoxycarbonyl)Furan-2-Yl)Boronic Acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 25g.
(5-methoxycarbonylfuran-2-yl)boronic acid (CAS 876189-20-7) is a chemical compound with the molecular formula C6H7BO5 and a molecular weight of 169.93 g/mol. IUPAC name: (5-methoxycarbonylfuran-2-yl)boronic acid. InChIKey: PGQQERRFTSQHHN-UHFFFAOYSA-N.
| Molecular formula | C6H7BO5 |
|---|---|
| Molecular weight | 169.93 g/mol |
| IUPAC name | (5-methoxycarbonylfuran-2-yl)boronic acid |
| InChIKey | PGQQERRFTSQHHN-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(O1)C(=O)OC)(O)O |
Computed by PubChem (NCBI)