cas: 925921-29-5 — see every product listed under this CAS number, including other names
(5-(tert-Butoxycarbonyl)thiophen-2-yl)boronic acid 96% (CAS 925921-29-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A170635-100mg |
| cas | 925921-29-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 648.50 Pln | |
| Ambeed | 250mg | 1043.44 Pln | |
| Ambeed | 1g | 3001.44 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A170635 |
[5-[(2-methylpropan-2-yl)oxycarbonyl]thiophen-2-yl]boronic acid (CAS 925921-29-5) is a chemical compound with the molecular formula C9H13BO4S and a molecular weight of 228.08 g/mol. IUPAC name: [5-[(2-methylpropan-2-yl)oxycarbonyl]thiophen-2-yl]boronic acid. InChIKey: LKQDOTUUIDJQFS-UHFFFAOYSA-N.
| Molecular formula | C9H13BO4S |
|---|---|
| Molecular weight | 228.08 g/mol |
| IUPAC name | [5-[(2-methylpropan-2-yl)oxycarbonyl]thiophen-2-yl]boronic acid |
| InChIKey | LKQDOTUUIDJQFS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(S1)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)