CAS 1217501-34-2 appears in our catalog under these names: 4-(Propylsulfonyl)phenylboronic acid, 98%, (4-(Propylsulfonyl)phenyl)boronic acid 98%, (4-(Propylsulfonyl)phenyl)boronic acid, 98%, 98%, (4-(Propylsulfonyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
(4-propylsulfonylphenyl)boronic acid (CAS 1217501-34-2) is a chemical compound with the molecular formula C9H13BO4S and a molecular weight of 228.08 g/mol. IUPAC name: (4-propylsulfonylphenyl)boronic acid. InChIKey: JWRPDLRKXOTPJH-UHFFFAOYSA-N.
| Molecular formula | C9H13BO4S |
|---|---|
| Molecular weight | 228.08 g/mol |
| IUPAC name | (4-propylsulfonylphenyl)boronic acid |
| InChIKey | JWRPDLRKXOTPJH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)CCC)(O)O |
Computed by PubChem (NCBI)