CAS 925921-29-5 appears in our catalog under these names: 5-tert-Butoxycarbonylthiophene-2-boronic acid, 96%, (5-(tert-Butoxycarbonyl)thiophen-2-yl)boronic acid, 98%, (5-(tert-Butoxycarbonyl)thiophen-2-yl)boronic acid 96%, (5-(tert-Butoxycarbonyl)thiophen-2-yl)boronic acid, 96%, 96%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg.
[5-[(2-methylpropan-2-yl)oxycarbonyl]thiophen-2-yl]boronic acid (CAS 925921-29-5) is a chemical compound with the molecular formula C9H13BO4S and a molecular weight of 228.08 g/mol. IUPAC name: [5-[(2-methylpropan-2-yl)oxycarbonyl]thiophen-2-yl]boronic acid. InChIKey: LKQDOTUUIDJQFS-UHFFFAOYSA-N.
| Molecular formula | C9H13BO4S |
|---|---|
| Molecular weight | 228.08 g/mol |
| IUPAC name | [5-[(2-methylpropan-2-yl)oxycarbonyl]thiophen-2-yl]boronic acid |
| InChIKey | LKQDOTUUIDJQFS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(S1)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)