cas: 1360568-68-8 — see every product listed under this CAS number, including other names
(5-Bromo-2-chlorophenyl)(4-hydroxyphenyl)methanone 98% (CAS 1360568-68-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1387666-1g |
| cas | 1360568-68-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 392.62 Pln | |
| Ambeed | 10g | 592.88 Pln | |
| Ambeed | 25g | 904.38 Pln | |
| Ambeed | 100g | 2534.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1387666 |
(5-bromo-2-chlorophenyl)-(4-hydroxyphenyl)methanone (CAS 1360568-68-8) is a chemical compound with the molecular formula C13H8BrClO2 and a molecular weight of 311.56 g/mol. IUPAC name: (5-bromo-2-chlorophenyl)-(4-hydroxyphenyl)methanone. InChIKey: BSKHBYQWMYSDHW-UHFFFAOYSA-N.
| Molecular formula | C13H8BrClO2 |
|---|---|
| Molecular weight | 311.56 g/mol |
| IUPAC name | (5-bromo-2-chlorophenyl)-(4-hydroxyphenyl)methanone |
| InChIKey | BSKHBYQWMYSDHW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(C=CC(=C2)Br)Cl)O |
Computed by PubChem (NCBI)