cas: 1360568-68-8 — see every product listed under this CAS number, including other names
(5-Bromo-2-chlorophenyl)(4-hydroxyphenyl)methanone, 98%, 98% (CAS 1360568-68-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110XFU-1g |
| cas | 1360568-68-8 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 309.20 Pln | |
| Chemat | 10g | 462.80 Pln | |
| Chemat | 25g | 698.00 Pln | |
| Chemat | 100g | 1950.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(5-bromo-2-chlorophenyl)-(4-hydroxyphenyl)methanone (CAS 1360568-68-8) is a chemical compound with the molecular formula C13H8BrClO2 and a molecular weight of 311.56 g/mol. IUPAC name: (5-bromo-2-chlorophenyl)-(4-hydroxyphenyl)methanone. InChIKey: BSKHBYQWMYSDHW-UHFFFAOYSA-N.
| Molecular formula | C13H8BrClO2 |
|---|---|
| Molecular weight | 311.56 g/mol |
| IUPAC name | (5-bromo-2-chlorophenyl)-(4-hydroxyphenyl)methanone |
| InChIKey | BSKHBYQWMYSDHW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(C=CC(=C2)Br)Cl)O |
Computed by PubChem (NCBI)