cas: 1270377-73-5 — see every product listed under this CAS number, including other names
(5-Bromo-2-fluorophenyl)(cyclopropyl)methanamine 95% (CAS 1270377-73-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1159294-1g |
| cas | 1270377-73-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 1104.63 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1159294 |
(5-bromo-2-fluorophenyl)-cyclopropylmethanamine (CAS 1270377-73-5) is a chemical compound with the molecular formula C10H11BrFN and a molecular weight of 244.10 g/mol. IUPAC name: (5-bromo-2-fluorophenyl)-cyclopropylmethanamine. InChIKey: LVFQLBOMQVKLIJ-UHFFFAOYSA-N.
| Molecular formula | C10H11BrFN |
|---|---|
| Molecular weight | 244.10 g/mol |
| IUPAC name | (5-bromo-2-fluorophenyl)-cyclopropylmethanamine |
| InChIKey | LVFQLBOMQVKLIJ-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=C(C=CC(=C2)Br)F)N |
Computed by PubChem (NCBI)