Products 926201-08-3
CAS 926201-08-3 appears in our catalog under these names: 4-Bromo-1-fluoro-2-(cyclopropanaminomethyl)benzene, 98%, 4-Bromo-1-fluoro-2-(cyclopropanaminomethyl)benzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 5g.
N-[(5-bromo-2-fluorophenyl)methyl]cyclopropanamine (CAS 926201-08-3) is a chemical compound with the molecular formula C10H11BrFN and a molecular weight of 244.10 g/mol. IUPAC name: N-[(5-bromo-2-fluorophenyl)methyl]cyclopropanamine. InChIKey: TUGQAZYOTSHQHC-UHFFFAOYSA-N.
| Molecular formula | C10H11BrFN |
|---|---|
| Molecular weight | 244.10 g/mol |
| IUPAC name | N-[(5-bromo-2-fluorophenyl)methyl]cyclopropanamine |
| InChIKey | TUGQAZYOTSHQHC-UHFFFAOYSA-N |
| SMILES | C1CC1NCC2=C(C=CC(=C2)Br)F |
Computed by PubChem (NCBI)