CAS 1280786-82-4 is the registry number for 4-Bromo-1-fluoro-2-pyrrolidinobenzene, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.
1-(5-bromo-2-fluorophenyl)pyrrolidine (CAS 1280786-82-4) is a chemical compound with the molecular formula C10H11BrFN and a molecular weight of 244.10 g/mol. IUPAC name: 1-(5-bromo-2-fluorophenyl)pyrrolidine. InChIKey: BTRJHVUIVJNGBI-UHFFFAOYSA-N.
| Molecular formula | C10H11BrFN |
|---|---|
| Molecular weight | 244.10 g/mol |
| IUPAC name | 1-(5-bromo-2-fluorophenyl)pyrrolidine |
| InChIKey | BTRJHVUIVJNGBI-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=C(C=CC(=C2)Br)F |
Computed by PubChem (NCBI)