cas: 2096339-93-2 — see every product listed under this CAS number, including other names
(5-Chloro-2,3-dimethoxypyridin-4-yl)boronic acid 97% (CAS 2096339-93-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A435207-100mg |
| cas | 2096339-93-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 487.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A435207 |
(5-chloro-2,3-dimethoxy-4-pyridinyl)boronic acid (CAS 2096339-93-2) is a chemical compound with the molecular formula C7H9BClNO4 and a molecular weight of 217.42 g/mol. IUPAC name: (5-chloro-2,3-dimethoxy-4-pyridinyl)boronic acid. InChIKey: ULFBXDQPYQISEH-UHFFFAOYSA-N.
| Molecular formula | C7H9BClNO4 |
|---|---|
| Molecular weight | 217.42 g/mol |
| IUPAC name | (5-chloro-2,3-dimethoxy-4-pyridinyl)boronic acid |
| InChIKey | ULFBXDQPYQISEH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=NC=C1Cl)OC)OC)(O)O |
Computed by PubChem (NCBI)