cas: 2096339-93-2 — see every product listed under this CAS number, including other names
5-Chloro-2,3-dimethoxypyridine-4-boronic acid, 97%, 97% (CAS 2096339-93-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHNB-100mg |
| cas | 2096339-93-2 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 285.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(5-chloro-2,3-dimethoxy-4-pyridinyl)boronic acid (CAS 2096339-93-2) is a chemical compound with the molecular formula C7H9BClNO4 and a molecular weight of 217.42 g/mol. IUPAC name: (5-chloro-2,3-dimethoxy-4-pyridinyl)boronic acid. InChIKey: ULFBXDQPYQISEH-UHFFFAOYSA-N.
| Molecular formula | C7H9BClNO4 |
|---|---|
| Molecular weight | 217.42 g/mol |
| IUPAC name | (5-chloro-2,3-dimethoxy-4-pyridinyl)boronic acid |
| InChIKey | ULFBXDQPYQISEH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=NC=C1Cl)OC)OC)(O)O |
Computed by PubChem (NCBI)