cas: 1022-13-5 — see every product listed under this CAS number, including other names
(5-Chloro-2-(methylamino)phenyl)(phenyl)methanone, 98% (CAS 1022-13-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F241180-1G |
| cas | 1022-13-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 10g | 96.86 Pln | |
| Fluorochem | 25g | 107.27 Pln | |
| Fluorochem | 100g | 154.13 Pln | |
| Fluorochem | 500g | 445.69 Pln | |
| Fluorochem | 1kg | 830.98 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
[5-chloro-2-(methylamino)phenyl]-phenylmethanone (CAS 1022-13-5) is a chemical compound with the molecular formula C14H12ClNO and a molecular weight of 245.70 g/mol. IUPAC name: [5-chloro-2-(methylamino)phenyl]-phenylmethanone. InChIKey: WPNMLCMTDCANOZ-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | [5-chloro-2-(methylamino)phenyl]-phenylmethanone |
| InChIKey | WPNMLCMTDCANOZ-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)Cl)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)