cas: 1022-13-5 — see every product listed under this CAS number, including other names
5-Chloro-2-(methylamino)benzophenone, 99.38% (CAS 1022-13-5) is a chemical reagent available from Chemat. Available pack sizes: 1 kg, 50 g, 500 g, 25 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W011991-1 kg |
| cas | 1022-13-5 |
| size | 1 kg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 kg | 1346.02 Pln | |
| MedChemExpress | 50 g | 310.40 Pln | |
| MedChemExpress | 500 g | 886.26 Pln | |
| MedChemExpress | 25 g | 240.74 Pln | |
| MedChemExpress | 100 g | 426.50 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.38% |
[5-chloro-2-(methylamino)phenyl]-phenylmethanone (CAS 1022-13-5) is a chemical compound with the molecular formula C14H12ClNO and a molecular weight of 245.70 g/mol. IUPAC name: [5-chloro-2-(methylamino)phenyl]-phenylmethanone. InChIKey: WPNMLCMTDCANOZ-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | [5-chloro-2-(methylamino)phenyl]-phenylmethanone |
| InChIKey | WPNMLCMTDCANOZ-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)Cl)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)