cas: 2490704-97-5 — see every product listed under this CAS number, including other names
(5-Cyclopropylpyridin-2-yl)methanamine dihydrochloride, 97%, 97% (CAS 2490704-97-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch130JXK-50mg |
| cas | 2490704-97-5 |
| size | 50mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 1442.00 Pln | |
| Chemat | 100mg | 2474.00 Pln | |
| Chemat | 250mg | 3851.60 Pln | |
| Chemat | 500mg | 5229.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(5-cyclopropyl-2-pyridinyl)methanamine;dihydrochloride (CAS 2490704-97-5) is a chemical compound with the molecular formula C9H14Cl2N2 and a molecular weight of 221.12 g/mol. IUPAC name: (5-cyclopropyl-2-pyridinyl)methanamine;dihydrochloride. InChIKey: KTCMNEPZQONZKW-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2 |
|---|---|
| Molecular weight | 221.12 g/mol |
| IUPAC name | (5-cyclopropyl-2-pyridinyl)methanamine;dihydrochloride |
| InChIKey | KTCMNEPZQONZKW-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CN=C(C=C2)CN.Cl.Cl |
Computed by PubChem (NCBI)