CAS 1408058-15-0 appears in our catalog under these names: 3-(Aminomethyl)indoline dihydrochloride, 95%, 3–(Aminomethyl)indoline Dihydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg.
2,3-dihydro-1H-indol-3-ylmethanamine;dihydrochloride (CAS 1408058-15-0) is a chemical compound with the molecular formula C9H14Cl2N2 and a molecular weight of 221.12 g/mol. IUPAC name: 2,3-dihydro-1H-indol-3-ylmethanamine;dihydrochloride. InChIKey: ARTTZLFUCMQWKJ-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2 |
|---|---|
| Molecular weight | 221.12 g/mol |
| IUPAC name | 2,3-dihydro-1H-indol-3-ylmethanamine;dihydrochloride |
| InChIKey | ARTTZLFUCMQWKJ-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC=CC=C2N1)CN.Cl.Cl |
Computed by PubChem (NCBI)