CAS 1187929-87-8 appears in our catalog under these names: 5,6,7,8–Tetrahydroquinolin–8–amine dihydrochloride, 5,6,7,8-Tetrahydroquinolin-8-amine dihydrochloride 95%, 5,6,7,8-TETRAHYDROQUINOLIN-8-AMINE 2HCL, 95%, 5,6,7,8-Tetrahydro-quinolin-8-ylamine dihydrochloride, 96%, 5,6,7,8-Tetrahydroquinolin-8-amine dihydrochloride, 95%, 95%. Offered by: GLPBio, Ambeed, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g, 10g.
5,6,7,8-tetrahydroquinolin-8-amine;dihydrochloride (CAS 1187929-87-8) is a chemical compound with the molecular formula C9H14Cl2N2 and a molecular weight of 221.12 g/mol. IUPAC name: 5,6,7,8-tetrahydroquinolin-8-amine;dihydrochloride. InChIKey: DTETYNWEDVEEFT-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2 |
|---|---|
| Molecular weight | 221.12 g/mol |
| IUPAC name | 5,6,7,8-tetrahydroquinolin-8-amine;dihydrochloride |
| InChIKey | DTETYNWEDVEEFT-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=CC=N2)N.Cl.Cl |
Computed by PubChem (NCBI)