cas: 1002557-11-0 — see every product listed under this CAS number, including other names
(5-Fluorobiphenyl-2-yl)methanamine 95% (CAS 1002557-11-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A133002-250mg |
| cas | 1002557-11-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1772.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A133002 |
(4-fluoro-2-phenylphenyl)methanamine (CAS 1002557-11-0) is a chemical compound with the molecular formula C13H12FN and a molecular weight of 201.24 g/mol. IUPAC name: (4-fluoro-2-phenylphenyl)methanamine. InChIKey: YRGMOGJZQSBAOL-UHFFFAOYSA-N.
| Molecular formula | C13H12FN |
|---|---|
| Molecular weight | 201.24 g/mol |
| IUPAC name | (4-fluoro-2-phenylphenyl)methanamine |
| InChIKey | YRGMOGJZQSBAOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC(=C2)F)CN |
Computed by PubChem (NCBI)