CAS 1002557-11-0 appears in our catalog under these names: (5-Fluorobiphenyl-2-yl)methanamine, 95%, (5–Fluorobiphenyl–2–yl)methanamine, (5-Fluorobiphenyl-2-yl)methanamine 95%, (5-Fluorobiphenyl-2-yl)methanamine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
(4-fluoro-2-phenylphenyl)methanamine (CAS 1002557-11-0) is a chemical compound with the molecular formula C13H12FN and a molecular weight of 201.24 g/mol. IUPAC name: (4-fluoro-2-phenylphenyl)methanamine. InChIKey: YRGMOGJZQSBAOL-UHFFFAOYSA-N.
| Molecular formula | C13H12FN |
|---|---|
| Molecular weight | 201.24 g/mol |
| IUPAC name | (4-fluoro-2-phenylphenyl)methanamine |
| InChIKey | YRGMOGJZQSBAOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC(=C2)F)CN |
Computed by PubChem (NCBI)