CAS 1694468-64-8 is the registry number for 4'-Fluoro-2-methyl-[1,1'-biphenyl]-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-(4-fluorophenyl)-2-methylaniline (CAS 1694468-64-8) is a chemical compound with the molecular formula C13H12FN and a molecular weight of 201.24 g/mol. IUPAC name: 3-(4-fluorophenyl)-2-methylaniline. InChIKey: YYFYUGKBPVOREL-UHFFFAOYSA-N.
| Molecular formula | C13H12FN |
|---|---|
| Molecular weight | 201.24 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-2-methylaniline |
| InChIKey | YYFYUGKBPVOREL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1N)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)