cas: 153863-35-5 — see every product listed under this CAS number, including other names
(5-Methyl-1-phenyl-1H-pyrazol-4-yl)-methanol (CAS 153863-35-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F316942-250MG |
| cas | 153863-35-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 1174.60 Pln | |
| Fluorochem | 5g | 3564.39 Pln |
| delivery time | 3-4 weeks |
|---|
(5-methyl-1-phenylpyrazol-4-yl)methanol (CAS 153863-35-5) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: (5-methyl-1-phenylpyrazol-4-yl)methanol. InChIKey: JTNWKZVHKLAHTN-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | (5-methyl-1-phenylpyrazol-4-yl)methanol |
| InChIKey | JTNWKZVHKLAHTN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C2=CC=CC=C2)CO |
Computed by PubChem (NCBI)