Products 288401-54-7
CAS 288401-54-7 appears in our catalog under these names: 3-(3,5-Dimethyl-2-hydroxyphenyl)pyrazole, 98%, 3-(3,5-Dimethyl-2-hydroxyphenyl)pyrazole. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
2,4-dimethyl-6-(1H-pyrazol-5-yl)phenol (CAS 288401-54-7) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: 2,4-dimethyl-6-(1H-pyrazol-5-yl)phenol. InChIKey: UGVJBLJONNYBHH-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 2,4-dimethyl-6-(1H-pyrazol-5-yl)phenol |
| InChIKey | UGVJBLJONNYBHH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C2=CC=NN2)O)C |
Computed by PubChem (NCBI)