CAS 338997-02-7 is the registry number for N-[(1,2-Dimethylindol-3-yl)methylidene]hydroxylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(NE)-N-[(1,2-dimethylindol-3-yl)methylidene]hydroxylamine (CAS 338997-02-7) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: (NE)-N-[(1,2-dimethylindol-3-yl)methylidene]hydroxylamine. InChIKey: ALPRXCPXIOIWSS-KPKJPENVSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | (NE)-N-[(1,2-dimethylindol-3-yl)methylidene]hydroxylamine |
| InChIKey | ALPRXCPXIOIWSS-KPKJPENVSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1C)/C=N/O |
Computed by PubChem (NCBI)