cas: 2493-04-1 — see every product listed under this CAS number, including other names
(5-Nitrofuran-2-yl)methanol 96% (CAS 2493-04-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A449126-250mg |
| cas | 2493-04-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 670.75 Pln | |
| Ambeed | 25g | 2345.06 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A449126 |
(5-nitrofuran-2-yl)methanol (CAS 2493-04-1) is a chemical compound with the molecular formula C5H5NO4 and a molecular weight of 143.10 g/mol. IUPAC name: (5-nitrofuran-2-yl)methanol. InChIKey: NDSTUUPEXNCUNW-UHFFFAOYSA-N.
| Molecular formula | C5H5NO4 |
|---|---|
| Molecular weight | 143.10 g/mol |
| IUPAC name | (5-nitrofuran-2-yl)methanol |
| InChIKey | NDSTUUPEXNCUNW-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)[N+](=O)[O-])CO |
Computed by PubChem (NCBI)