cas: 2493-04-1 — see every product listed under this CAS number, including other names
(5-Nitrofuran-2-yl)methanol, 96%, 96% (CAS 2493-04-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113PXB-250mg |
| cas | 2493-04-1 |
| size | 250mg |
| availability | 48g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 453.20 Pln | |
| Chemat | 25g | 1926.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(5-nitrofuran-2-yl)methanol (CAS 2493-04-1) is a chemical compound with the molecular formula C5H5NO4 and a molecular weight of 143.10 g/mol. IUPAC name: (5-nitrofuran-2-yl)methanol. InChIKey: NDSTUUPEXNCUNW-UHFFFAOYSA-N.
| Molecular formula | C5H5NO4 |
|---|---|
| Molecular weight | 143.10 g/mol |
| IUPAC name | (5-nitrofuran-2-yl)methanol |
| InChIKey | NDSTUUPEXNCUNW-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)[N+](=O)[O-])CO |
Computed by PubChem (NCBI)