Products 6251-17-8

CAS 6251-17-8 is the registry number for 2-(2,4-Dioxoazetidin-1-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(2,4-dioxoazetidin-1-yl)acetic acid (CAS 6251-17-8) is a chemical compound with the molecular formula C5H5NO4 and a molecular weight of 143.10 g/mol. IUPAC name: 2-(2,4-dioxoazetidin-1-yl)acetic acid. InChIKey: LIPRQGQFNYDCGQ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5NO4
Molecular weight143.10 g/mol
IUPAC name2-(2,4-dioxoazetidin-1-yl)acetic acid
InChIKeyLIPRQGQFNYDCGQ-UHFFFAOYSA-N
SMILESC1C(=O)N(C1=O)CC(=O)O

Computed by PubChem (NCBI)