cas: 196083-20-2 — see every product listed under this CAS number, including other names
(6-(2,2,2-Trifluoroethoxy)-3-pyridinyl)boronic acid 98% (CAS 196083-20-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A391637-100mg |
| cas | 196083-20-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 476.06 Pln | |
| Ambeed | 250mg | 670.75 Pln | |
| Ambeed | 1g | 1282.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A391637 |
[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]boronic acid (CAS 196083-20-2) is a chemical compound with the molecular formula C7H7BF3NO3 and a molecular weight of 220.94 g/mol. IUPAC name: [6-(2,2,2-trifluoroethoxy)-3-pyridinyl]boronic acid. InChIKey: OGBJEQPXZICXNY-UHFFFAOYSA-N.
| Molecular formula | C7H7BF3NO3 |
|---|---|
| Molecular weight | 220.94 g/mol |
| IUPAC name | [6-(2,2,2-trifluoroethoxy)-3-pyridinyl]boronic acid |
| InChIKey | OGBJEQPXZICXNY-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)OCC(F)(F)F)(O)O |
Computed by PubChem (NCBI)