CAS 196083-20-2 appears in our catalog under these names: [6-(2,2,2-Trifluoroethoxy)pyridin-3-yl]boronic acid, 98%, (6-(2,2,2-Trifluoroethoxy)-3-pyridinyl)boronic acid, 98%, 98%, (6-(2,2,2-Trifluoroethoxy)-3-pyridinyl)boronic acid, ≥95%, (6-(2,2,2-Trifluoroethoxy)-3-pyridinyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]boronic acid (CAS 196083-20-2) is a chemical compound with the molecular formula C7H7BF3NO3 and a molecular weight of 220.94 g/mol. IUPAC name: [6-(2,2,2-trifluoroethoxy)-3-pyridinyl]boronic acid. InChIKey: OGBJEQPXZICXNY-UHFFFAOYSA-N.
| Molecular formula | C7H7BF3NO3 |
|---|---|
| Molecular weight | 220.94 g/mol |
| IUPAC name | [6-(2,2,2-trifluoroethoxy)-3-pyridinyl]boronic acid |
| InChIKey | OGBJEQPXZICXNY-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)OCC(F)(F)F)(O)O |
Computed by PubChem (NCBI)