CAS 1605331-76-7 appears in our catalog under these names: 2-Methoxy-6-(trifluoromethyl)pyridine-4-boronic acid, 98%, (2-Methoxy-6-(trifluoromethyl)pyridin-4-yl)boronic acid, 97%, 2–Methoxy–6–(trifluoromethyl)pyridine–4–boronic acid, 2-Methoxy-6-(trifluoromethyl)pyridine-4-boronic acid, 95%, 95%, (2-Methoxy-6-(trifluoromethyl)pyridin-4-yl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 5g, 100mg, 25mg, 5mg, 250mg.
[2-methoxy-6-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS 1605331-76-7) is a chemical compound with the molecular formula C7H7BF3NO3 and a molecular weight of 220.94 g/mol. IUPAC name: [2-methoxy-6-(trifluoromethyl)-4-pyridinyl]boronic acid. InChIKey: ZGPJQGHMUXHGFB-UHFFFAOYSA-N.
| Molecular formula | C7H7BF3NO3 |
|---|---|
| Molecular weight | 220.94 g/mol |
| IUPAC name | [2-methoxy-6-(trifluoromethyl)-4-pyridinyl]boronic acid |
| InChIKey | ZGPJQGHMUXHGFB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)OC)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)