cas: 1072944-22-9 — see every product listed under this CAS number, including other names
(6-Bromo-2-methylpyridin-3-yl)boronic acid 98% (CAS 1072944-22-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A528234-250mg |
| cas | 1072944-22-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 270.25 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1143.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A528234 |
(6-bromo-2-methyl-3-pyridinyl)boronic acid (CAS 1072944-22-9) is a chemical compound with the molecular formula C6H7BBrNO2 and a molecular weight of 215.84 g/mol. IUPAC name: (6-bromo-2-methyl-3-pyridinyl)boronic acid. InChIKey: NXLYPZNXELJJDT-UHFFFAOYSA-N.
| Molecular formula | C6H7BBrNO2 |
|---|---|
| Molecular weight | 215.84 g/mol |
| IUPAC name | (6-bromo-2-methyl-3-pyridinyl)boronic acid |
| InChIKey | NXLYPZNXELJJDT-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)Br)C)(O)O |
Computed by PubChem (NCBI)