Products 1451391-27-7

CAS 1451391-27-7 is the registry number for 5-Bromo-3-methylpyridine-4-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(3-bromo-5-methyl-4-pyridinyl)boronic acid (CAS 1451391-27-7) is a chemical compound with the molecular formula C6H7BBrNO2 and a molecular weight of 215.84 g/mol. IUPAC name: (3-bromo-5-methyl-4-pyridinyl)boronic acid. InChIKey: PIXOGEQZARNYOX-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7BBrNO2
Molecular weight215.84 g/mol
IUPAC name(3-bromo-5-methyl-4-pyridinyl)boronic acid
InChIKeyPIXOGEQZARNYOX-UHFFFAOYSA-N
SMILESB(C1=C(C=NC=C1C)Br)(O)O

Computed by PubChem (NCBI)