CAS 2225181-29-1 appears in our catalog under these names: 2-Bromo-6-methylpyridine-4-boronic acid, 95%, 2–Bromo–6–methylpyridine–4–boronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg, 25mg, 5mg.
(2-bromo-6-methyl-4-pyridinyl)boronic acid (CAS 2225181-29-1) is a chemical compound with the molecular formula C6H7BBrNO2 and a molecular weight of 215.84 g/mol. IUPAC name: (2-bromo-6-methyl-4-pyridinyl)boronic acid. InChIKey: CICVUFPZQTWKQX-UHFFFAOYSA-N.
| Molecular formula | C6H7BBrNO2 |
|---|---|
| Molecular weight | 215.84 g/mol |
| IUPAC name | (2-bromo-6-methyl-4-pyridinyl)boronic acid |
| InChIKey | CICVUFPZQTWKQX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)Br)C)(O)O |
Computed by PubChem (NCBI)