cas: 1150114-39-8 — see every product listed under this CAS number, including other names
(6-Bromobenzo[d][1,3]dioxol-4-yl)boronic acid 98% (CAS 1150114-39-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A178562-250mg |
| cas | 1150114-39-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A178562 |
(6-bromo-1,3-benzodioxol-4-yl)boronic acid (CAS 1150114-39-8) is a chemical compound with the molecular formula C7H6BBrO4 and a molecular weight of 244.84 g/mol. IUPAC name: (6-bromo-1,3-benzodioxol-4-yl)boronic acid. InChIKey: IYXFZDKGXKBASE-UHFFFAOYSA-N.
| Molecular formula | C7H6BBrO4 |
|---|---|
| Molecular weight | 244.84 g/mol |
| IUPAC name | (6-bromo-1,3-benzodioxol-4-yl)boronic acid |
| InChIKey | IYXFZDKGXKBASE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC2=C1OCO2)Br)(O)O |
Computed by PubChem (NCBI)