CAS 1150114-39-8 appears in our catalog under these names: 5-Bromo-2,3-methylenedioxyphenylboronic acid, 98%, (6-Bromobenzo[d][1,3]dioxol-4-yl)boronic acid 98%, (6-Bromobenzo[d][1,3]dioxol-4-yl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
(6-bromo-1,3-benzodioxol-4-yl)boronic acid (CAS 1150114-39-8) is a chemical compound with the molecular formula C7H6BBrO4 and a molecular weight of 244.84 g/mol. IUPAC name: (6-bromo-1,3-benzodioxol-4-yl)boronic acid. InChIKey: IYXFZDKGXKBASE-UHFFFAOYSA-N.
| Molecular formula | C7H6BBrO4 |
|---|---|
| Molecular weight | 244.84 g/mol |
| IUPAC name | (6-bromo-1,3-benzodioxol-4-yl)boronic acid |
| InChIKey | IYXFZDKGXKBASE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC2=C1OCO2)Br)(O)O |
Computed by PubChem (NCBI)